C10H15ClFN3 — CID 115261315
2-(3-chloro-4-fluorophenyl)-N-(hydrazinylmethyl)-N-methylethanamine (PubChem CID 115261315) has the molecular formula C10H15ClFN3 and a molecular weight of 231.70 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-N-(hydrazinylmethyl)-N-methylethanamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-N-(hydrazinylmethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115261315 |
| Molecular Formula | C10H15ClFN3 |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-N-(hydrazinylmethyl)-N-methylethanamine |
| SMILES | CN(CCc1ccc(F)c(Cl)c1)CNN |
| InChI | InChI=1S/C10H15ClFN3/c1-15(7-14-13)5-4-8-2-3-10(12)9(11)6-8/h2-3,6,14H,4-5,7,13H2,1H3 |
| InChIKey | GFNWFVLCTQTJKZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|