C13H12BrN5O — CID 115264570
[6-(5-bromo-2-methoxy-N-methylanilino)pyrimidin-4-yl]cyanamide (PubChem CID 115264570) has the molecular formula C13H12BrN5O and a molecular weight of 334.18 g/mol. Its IUPAC name is [6-(5-bromo-2-methoxy-N-methylanilino)pyrimidin-4-yl]cyanamide.
| Compound Name | [6-(5-bromo-2-methoxy-N-methylanilino)pyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115264570 |
| Molecular Formula | C13H12BrN5O |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | [6-(5-bromo-2-methoxy-N-methylanilino)pyrimidin-4-yl]cyanamide |
| SMILES | COc1ccc(Br)cc1N(C)c1cc(NC#N)ncn1 |
| InChI | InChI=1S/C13H12BrN5O/c1-19(10-5-9(14)3-4-11(10)20-2)13-6-12(16-7-15)17-8-18-13/h3-6,8H,1-2H3,(H,16,17,18) |
| InChIKey | OTCVUXMMTTYKNH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|