C11H10BrN5S — CID 115264820
2-[[6-[(5-bromothiophen-2-yl)-methylamino]pyrimidin-4-yl]amino]acetonitrile (PubChem CID 115264820) has the molecular formula C11H10BrN5S and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-[[6-[(5-bromothiophen-2-yl)-methylamino]pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[6-[(5-bromothiophen-2-yl)-methylamino]pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115264820 |
| Molecular Formula | C11H10BrN5S |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-[[6-[(5-bromothiophen-2-yl)-methylamino]pyrimidin-4-yl]amino]acetonitrile |
| SMILES | CN(c1cc(NCC#N)ncn1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H10BrN5S/c1-17(11-3-2-8(12)18-11)10-6-9(14-5-4-13)15-7-16-10/h2-3,6-7H,5H2,1H3,(H,14,15,16) |
| InChIKey | PLTHRIJOFGBQDO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|