C12H17N5 — CID 115265704
6-N-ethyl-4-N-[2-(1H-pyrrol-2-yl)ethyl]pyrimidine-4,6-diamine (PubChem CID 115265704) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-N-ethyl-4-N-[2-(1H-pyrrol-2-yl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-[2-(1H-pyrrol-2-yl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115265704 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 6-N-ethyl-4-N-[2-(1H-pyrrol-2-yl)ethyl]pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCc2ccc[nH]2)ncn1 |
| InChI | InChI=1S/C12H17N5/c1-2-13-11-8-12(17-9-16-11)15-7-5-10-4-3-6-14-10/h3-4,6,8-9,14H,2,5,7H2,1H3,(H2,13,15,16,17) |
| InChIKey | BBAMXYHQUCROLP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |