C14H11N5O — CID 115266030
[6-(1-benzofuran-3-ylamino)pyrimidin-4-yl]-methylcyanamide (PubChem CID 115266030) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is [6-(1-benzofuran-3-ylamino)pyrimidin-4-yl]-methylcyanamide.
| Compound Name | [6-(1-benzofuran-3-ylamino)pyrimidin-4-yl]-methylcyanamide |
|---|---|
| PubChem CID | 115266030 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [6-(1-benzofuran-3-ylamino)pyrimidin-4-yl]-methylcyanamide |
| SMILES | CN(C#N)c1cc(Nc2coc3ccccc23)ncn1 |
| InChI | InChI=1S/C14H11N5O/c1-19(8-15)14-6-13(16-9-17-14)18-11-7-20-12-5-3-2-4-10(11)12/h2-7,9H,1H3,(H,16,17,18) |
| InChIKey | MNADHHOPZNNBPI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|