C12H18N4O2 — CID 115266537
2-[[6-(cyclobutylamino)-2-methylpyrimidin-4-yl]amino]propanoic acid (PubChem CID 115266537) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-[[6-(cyclobutylamino)-2-methylpyrimidin-4-yl]amino]propanoic acid.
| Compound Name | 2-[[6-(cyclobutylamino)-2-methylpyrimidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 115266537 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[[6-(cyclobutylamino)-2-methylpyrimidin-4-yl]amino]propanoic acid |
| SMILES | Cc1nc(NC2CCC2)cc(NC(C)C(=O)O)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-7(12(17)18)13-10-6-11(15-8(2)14-10)16-9-4-3-5-9/h6-7,9H,3-5H2,1-2H3,(H,17,18)(H2,13,14,15,16) |
| InChIKey | PDZYEVKRPUUGEJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |