C12H12N6 — CID 115266775
2-[[2-methyl-6-(pyridin-3-ylamino)pyrimidin-4-yl]amino]acetonitrile (PubChem CID 115266775) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-[[2-methyl-6-(pyridin-3-ylamino)pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[2-methyl-6-(pyridin-3-ylamino)pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115266775 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[[2-methyl-6-(pyridin-3-ylamino)pyrimidin-4-yl]amino]acetonitrile |
| SMILES | Cc1nc(NCC#N)cc(Nc2cccnc2)n1 |
| InChI | InChI=1S/C12H12N6/c1-9-16-11(15-6-4-13)7-12(17-9)18-10-3-2-5-14-8-10/h2-3,5,7-8H,6H2,1H3,(H2,15,16,17,18) |
| InChIKey | QQEFTLFYJZHKKB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|