C11H19F3N2O2 — CID 115267203
ethyl 2-(methylaminomethyl)-2-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 115267203) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is ethyl 2-(methylaminomethyl)-2-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | ethyl 2-(methylaminomethyl)-2-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 115267203 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl 2-(methylaminomethyl)-2-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCCC1(CNC)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c1-3-18-9(17)16-7-5-4-6-10(16,8-15-2)11(12,13)14/h15H,3-8H2,1-2H3 |
| InChIKey | UNWJGHALBAPIQQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |