C11H20BrNO2 — CID 172844672
2-(bromomethyl)-2-tert-butylpiperidine-1-carboxylic acid (PubChem CID 172844672) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-(bromomethyl)-2-tert-butylpiperidine-1-carboxylic acid.
| Compound Name | 2-(bromomethyl)-2-tert-butylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 172844672 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(bromomethyl)-2-tert-butylpiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1(CBr)CCCCN1C(=O)O |
| InChI | InChI=1S/C11H20BrNO2/c1-10(2,3)11(8-12)6-4-5-7-13(11)9(14)15/h4-8H2,1-3H3,(H,14,15) |
| InChIKey | XGJGKMSJTKDAIB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|