C6H8FNO4 — CID 69306748
2-fluoropyrrolidine-1,2-dicarboxylic acid (PubChem CID 69306748) has the molecular formula C6H8FNO4 and a molecular weight of 177.13 g/mol. Its IUPAC name is 2-fluoropyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 2-fluoropyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 69306748 |
| Molecular Formula | C6H8FNO4 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-fluoropyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)N1CCCC1(F)C(=O)O |
| InChI | InChI=1S/C6H8FNO4/c7-6(4(9)10)2-1-3-8(6)5(11)12/h1-3H2,(H,9,10)(H,11,12) |
| InChIKey | OQKVQOSHFWUYKS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|