(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid

C7H9NO5 — CID 166692014

IUPAC(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid
SMILESO=C[C@]1(C(=O)O)CCCN1C(=O)O
InChIInChI=1S/C7H9NO5/c9-4-7(5(10)11)2-1-3-8(7)6(12)13/h4H,1-3H2,(H,10,11)(H,12,13)/t7-/m0/s1
InChIKeyGWLHJIPPBGALNB-ZETCQYMHSA-N
MW187.15 g/mol
LogP-0.22
Rot. Bonds2

About (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid

(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 166692014) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid
PubChem CID166692014
Molecular FormulaC7H9NO5
Molecular Weight187.15 g/mol
Exact Mass187.05
IUPAC Name(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid
SMILESO=C[C@]1(C(=O)O)CCCN1C(=O)O
InChIInChI=1S/C7H9NO5/c9-4-7(5(10)11)2-1-3-8(7)6(12)13/h4H,1-3H2,(H,10,11)(H,12,13)/t7-/m0/s1
InChIKeyGWLHJIPPBGALNB-ZETCQYMHSA-N
XLogP-0.22
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.15
LogP ≤ 5-0.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid (CID 166692014) is (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid is O=C[C@]1(C(=O)O)CCCN1C(=O)O.
What is the InChIKey of (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is GWLHJIPPBGALNB-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H9NO5/c9-4-7(5(10)11)2-1-3-8(7)6(12)13/h4H,1-3H2,(H,10,11)(H,12,13)/t7-/m0/s1.
What are the key properties of (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid?
(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 187.15 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 166692014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).