C7H9NO5 — CID 166692014
(2S)-2-formylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 166692014) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 166692014 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | (2S)-2-formylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C[C@]1(C(=O)O)CCCN1C(=O)O |
| InChI | InChI=1S/C7H9NO5/c9-4-7(5(10)11)2-1-3-8(7)6(12)13/h4H,1-3H2,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | GWLHJIPPBGALNB-ZETCQYMHSA-N |
| XLogP | -0.22 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|