C10H19N3O3 — CID 173091920
(2S)-2-tert-butyl-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylic acid (PubChem CID 173091920) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2S)-2-tert-butyl-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-tert-butyl-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 173091920 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | (2S)-2-tert-butyl-2-(N'-hydroxycarbamimidoyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@]1(C(N)=NO)CCCN1C(=O)O |
| InChI | InChI=1S/C10H19N3O3/c1-9(2,3)10(7(11)12-16)5-4-6-13(10)8(14)15/h16H,4-6H2,1-3H3,(H2,11,12)(H,14,15)/t10-/m1/s1 |
| InChIKey | MPJTVGXYMSFCLG-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|