methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate

C8H18N2O2 — CID 115267316

IUPACmethyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate
SMILESCNCC(C)(C)CNC(=O)OC
InChIInChI=1S/C8H18N2O2/c1-8(2,5-9-3)6-10-7(11)12-4/h9H,5-6H2,1-4H3,(H,10,11)
InChIKeyFLRBVYHNMMWQMJ-UHFFFAOYSA-N
MW174.24 g/mol
LogP0.59
Rot. Bonds4

About methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate

methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate (PubChem CID 115267316) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate.

Molecular Properties

Compound Namemethyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate
PubChem CID115267316
Molecular FormulaC8H18N2O2
Molecular Weight174.24 g/mol
Exact Mass174.14
IUPAC Namemethyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate
SMILESCNCC(C)(C)CNC(=O)OC
InChIInChI=1S/C8H18N2O2/c1-8(2,5-9-3)6-10-7(11)12-4/h9H,5-6H2,1-4H3,(H,10,11)
InChIKeyFLRBVYHNMMWQMJ-UHFFFAOYSA-N
XLogP0.59
TPSA50.36 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate?
The IUPAC name of methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate (CID 115267316) is methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate.
What is the SMILES notation for methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate?
The canonical SMILES for methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate is CNCC(C)(C)CNC(=O)OC.
What is the InChIKey of methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate?
The InChIKey is FLRBVYHNMMWQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-8(2,5-9-3)6-10-7(11)12-4/h9H,5-6H2,1-4H3,(H,10,11).
What are the key properties of methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate?
methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate has a molecular weight of 174.24 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2,2-dimethyl-3-(methylamino)propyl]carbamate is sourced from PubChem (CID 115267316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).