C36H43N3O2 — CID 11526829
(2S)-N-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxamide (PubChem CID 11526829) has the molecular formula C36H43N3O2 and a molecular weight of 549.76 g/mol. Its IUPAC name is (2S)-N-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 11526829 |
| Molecular Formula | C36H43N3O2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | (2S)-N-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1)N1CCC[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H43N3O2/c40-35(39-24-9-16-34(39)36(41,27-10-3-1-4-11-27)28-12-5-2-6-13-28)37-29-19-17-26(18-20-29)23-25-38-32-21-22-33(38)31-15-8-7-14-30(31)32/h1-8,10-15,26,29,32-34,41H,9,16-25H2,(H,37,40)/t26?,29?,32-,33+,34-/m0/s1 |
| InChIKey | VNHPACAMQLYDNK-ZFIAJTFXSA-N |
| XLogP | 6.94 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |