C30H35ClFN5O2 — CID 11526863
5-chloro-6-[4-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide (PubChem CID 11526863) has the molecular formula C30H35ClFN5O2 and a molecular weight of 552.09 g/mol. Its IUPAC name is 5-chloro-6-[4-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[4-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11526863 |
| Molecular Formula | C30H35ClFN5O2 |
| Molecular Weight | 552.09 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 5-chloro-6-[4-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(N2CCN(C3CCN(Cc4ccc(F)cc4)CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C30H35ClFN5O2/c31-28-20-24(30(38)33-12-19-39-27-4-2-1-3-5-27)21-34-29(28)37-17-15-36(16-18-37)26-10-13-35(14-11-26)22-23-6-8-25(32)9-7-23/h1-9,20-21,26H,10-19,22H2,(H,33,38) |
| InChIKey | ULSKMUIVQZPBAT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|