C14H18N4O — CID 115274634
N-(6-amino-3-pyridinyl)-N-methyl-4-(1H-pyrrol-3-yl)butanamide (PubChem CID 115274634) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-N-methyl-4-(1H-pyrrol-3-yl)butanamide.
| Compound Name | N-(6-amino-3-pyridinyl)-N-methyl-4-(1H-pyrrol-3-yl)butanamide |
|---|---|
| PubChem CID | 115274634 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-N-methyl-4-(1H-pyrrol-3-yl)butanamide |
| SMILES | CN(C(=O)CCCc1cc[nH]c1)c1ccc(N)nc1 |
| InChI | InChI=1S/C14H18N4O/c1-18(12-5-6-13(15)17-10-12)14(19)4-2-3-11-7-8-16-9-11/h5-10,16H,2-4H2,1H3,(H2,15,17) |
| InChIKey | UDHXLYKVZMXYJA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |