C9H17NO3 — CID 115278432
(3R,4S)-1-(2-hydroxycyclopentyl)pyrrolidine-3,4-diol (PubChem CID 115278432) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (3R,4S)-1-(2-hydroxycyclopentyl)pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(2-hydroxycyclopentyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 115278432 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3R,4S)-1-(2-hydroxycyclopentyl)pyrrolidine-3,4-diol |
| SMILES | OC1CCCC1N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C9H17NO3/c11-7-3-1-2-6(7)10-4-8(12)9(13)5-10/h6-9,11-13H,1-5H2/t6?,7?,8-,9+ |
| InChIKey | CSGVULFHSZRNOX-WZENYGAOSA-N |
| XLogP | -1.06 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |