C13H18N2O — CID 115282036
2-(2,5-dimethylphenyl)-3-ethylimidazolidin-4-one (PubChem CID 115282036) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-3-ethylimidazolidin-4-one.
| Compound Name | 2-(2,5-dimethylphenyl)-3-ethylimidazolidin-4-one |
|---|---|
| PubChem CID | 115282036 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-3-ethylimidazolidin-4-one |
| SMILES | CCN1C(=O)CNC1c1cc(C)ccc1C |
| InChI | InChI=1S/C13H18N2O/c1-4-15-12(16)8-14-13(15)11-7-9(2)5-6-10(11)3/h5-7,13-14H,4,8H2,1-3H3 |
| InChIKey | YAELAXXFGJEIFQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |