C16H22N2O2 — CID 83254467
2-(2,5-dimethylphenyl)-3-(oxolan-3-ylmethyl)imidazolidin-4-one (PubChem CID 83254467) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-3-(oxolan-3-ylmethyl)imidazolidin-4-one.
| Compound Name | 2-(2,5-dimethylphenyl)-3-(oxolan-3-ylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83254467 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-3-(oxolan-3-ylmethyl)imidazolidin-4-one |
| SMILES | Cc1ccc(C)c(C2NCC(=O)N2CC2CCOC2)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-11-3-4-12(2)14(7-11)16-17-8-15(19)18(16)9-13-5-6-20-10-13/h3-4,7,13,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | FAWZDAZYLDNMBR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |