C15H17ClN2O2 — CID 115282633
1-chloro-N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-3-carboxamide (PubChem CID 115282633) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 1-chloro-N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-3-carboxamide.
| Compound Name | 1-chloro-N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 115282633 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-chloro-N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-3-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(2,9-19)8-17-14(20)12-7-10-5-3-4-6-11(10)13(16)18-12/h3-7,19H,8-9H2,1-2H3,(H,17,20) |
| InChIKey | GRPOUFPTPBMHET-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|