C13H11ClN2O3 — CID 43343362
methyl 2-[(1-chloroisoquinoline-3-carbonyl)amino]acetate (PubChem CID 43343362) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.70 g/mol. Its IUPAC name is methyl 2-[(1-chloroisoquinoline-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(1-chloroisoquinoline-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 43343362 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | methyl 2-[(1-chloroisoquinoline-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C13H11ClN2O3/c1-19-11(17)7-15-13(18)10-6-8-4-2-3-5-9(8)12(14)16-10/h2-6H,7H2,1H3,(H,15,18) |
| InChIKey | ONMWUDWWCCZGKG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|