C12H9BrN2S2 — CID 115284850
(5-bromo-1,3-benzothiazol-2-yl)-thiophen-2-ylmethanamine (PubChem CID 115284850) has the molecular formula C12H9BrN2S2 and a molecular weight of 325.26 g/mol. Its IUPAC name is (5-bromo-1,3-benzothiazol-2-yl)-thiophen-2-ylmethanamine.
| Compound Name | (5-bromo-1,3-benzothiazol-2-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 115284850 |
| Molecular Formula | C12H9BrN2S2 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | (5-bromo-1,3-benzothiazol-2-yl)-thiophen-2-ylmethanamine |
| SMILES | NC(c1cccs1)c1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C12H9BrN2S2/c13-7-3-4-9-8(6-7)15-12(17-9)11(14)10-2-1-5-16-10/h1-6,11H,14H2 |
| InChIKey | DYUVKLDPAJCNKF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |