C12H9BrF3NOS — CID 171208041
(S)-[5-bromo-2-(trifluoromethoxy)phenyl]-thiophen-2-ylmethanamine (PubChem CID 171208041) has the molecular formula C12H9BrF3NOS and a molecular weight of 352.18 g/mol. Its IUPAC name is (S)-[5-bromo-2-(trifluoromethoxy)phenyl]-thiophen-2-ylmethanamine.
| Compound Name | (S)-[5-bromo-2-(trifluoromethoxy)phenyl]-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 171208041 |
| Molecular Formula | C12H9BrF3NOS |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | (S)-[5-bromo-2-(trifluoromethoxy)phenyl]-thiophen-2-ylmethanamine |
| SMILES | N[C@H](c1cccs1)c1cc(Br)ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H9BrF3NOS/c13-7-3-4-9(18-12(14,15)16)8(6-7)11(17)10-2-1-5-19-10/h1-6,11H,17H2/t11-/m0/s1 |
| InChIKey | SOSPYWWJJUJQHT-NSHDSACASA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |