C13H11BrF3NOS — CID 115850913
(5-bromo-4-methylthiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methanamine (PubChem CID 115850913) has the molecular formula C13H11BrF3NOS and a molecular weight of 366.20 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 115850913 |
| Molecular Formula | C13H11BrF3NOS |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-[2-(trifluoromethoxy)phenyl]methanamine |
| SMILES | Cc1cc(C(N)c2ccccc2OC(F)(F)F)sc1Br |
| InChI | InChI=1S/C13H11BrF3NOS/c1-7-6-10(20-12(7)14)11(18)8-4-2-3-5-9(8)19-13(15,16)17/h2-6,11H,18H2,1H3 |
| InChIKey | PXFATFUTSKEJFN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |