C12H11ClF3NO2S — CID 171210148
2-[(S)-amino(thiophen-2-yl)methyl]-4-(trifluoromethoxy)phenol;hydrochloride (PubChem CID 171210148) has the molecular formula C12H11ClF3NO2S and a molecular weight of 325.74 g/mol. Its IUPAC name is 2-[(S)-amino(thiophen-2-yl)methyl]-4-(trifluoromethoxy)phenol;hydrochloride.
| Compound Name | 2-[(S)-amino(thiophen-2-yl)methyl]-4-(trifluoromethoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 171210148 |
| Molecular Formula | C12H11ClF3NO2S |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-[(S)-amino(thiophen-2-yl)methyl]-4-(trifluoromethoxy)phenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cccs1)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H10F3NO2S.ClH/c13-12(14,15)18-7-3-4-9(17)8(6-7)11(16)10-2-1-5-19-10;/h1-6,11,17H,16H2;1H/t11-;/m0./s1 |
| InChIKey | BKTZNBNFLGMUOT-MERQFXBCSA-N |
| XLogP | 3.82 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|