C13H18N2O4S — CID 115287451
4-[(2-amino-2-thiophen-2-ylacetyl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 115287451) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-[(2-amino-2-thiophen-2-ylacetyl)-ethylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2-amino-2-thiophen-2-ylacetyl)-ethylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115287451 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-[(2-amino-2-thiophen-2-ylacetyl)-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(C(=O)C(N)c1cccs1)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H18N2O4S/c1-2-15(9-7-19-6-8(9)13(17)18)12(16)11(14)10-4-3-5-20-10/h3-5,8-9,11H,2,6-7,14H2,1H3,(H,17,18) |
| InChIKey | QAJZXWKDKSNQSD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |