C14H24OSi — CID 11528808
2-methyl-10-trimethylsilyldeca-3,9-diyn-2-ol (PubChem CID 11528808) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is 2-methyl-10-trimethylsilyldeca-3,9-diyn-2-ol.
| Compound Name | 2-methyl-10-trimethylsilyldeca-3,9-diyn-2-ol |
|---|---|
| PubChem CID | 11528808 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-methyl-10-trimethylsilyldeca-3,9-diyn-2-ol |
| SMILES | CC(C)(O)C#CCCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-14(2,15)12-10-8-6-7-9-11-13-16(3,4)5/h15H,6-9H2,1-5H3 |
| InChIKey | ZZPTYTSKNZQGND-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|