C12H19N3O3S — CID 115288096
2-[(2-butylsulfanylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 115288096) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[(2-butylsulfanylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[(2-butylsulfanylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 115288096 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[(2-butylsulfanylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | CCCCSCC(=O)NC(C(=O)O)c1cnn(C)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-3-4-5-19-8-10(16)14-11(12(17)18)9-6-13-15(2)7-9/h6-7,11H,3-5,8H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | ANJDIWHQMDRAJX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|