C13H20N4O3 — CID 115289055
2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 115289055) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 115289055 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | C=C(C)CN(CC)C(=O)NC(C(=O)O)c1cnn(C)c1 |
| InChI | InChI=1S/C13H20N4O3/c1-5-17(7-9(2)3)13(20)15-11(12(18)19)10-6-14-16(4)8-10/h6,8,11H,2,5,7H2,1,3-4H3,(H,15,20)(H,18,19) |
| InChIKey | YKHTVCOZVFLNDZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|