C12H14N4O3S — CID 115288789
2-[(2-amino-2-thiophen-2-ylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 115288789) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[(2-amino-2-thiophen-2-ylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid.
| Compound Name | 2-[(2-amino-2-thiophen-2-ylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 115288789 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[(2-amino-2-thiophen-2-ylacetyl)amino]-2-(1-methylpyrazol-4-yl)acetic acid |
| SMILES | Cn1cc(C(NC(=O)C(N)c2cccs2)C(=O)O)cn1 |
| InChI | InChI=1S/C12H14N4O3S/c1-16-6-7(5-14-16)10(12(18)19)15-11(17)9(13)8-3-2-4-20-8/h2-6,9-10H,13H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | CEMIWQOUGXOAEO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |