C14H17N3O3S — CID 115288173
2-(1-methylpyrazol-4-yl)-2-(4-thiophen-2-ylbutanoylamino)acetic acid (PubChem CID 115288173) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-2-(4-thiophen-2-ylbutanoylamino)acetic acid.
| Compound Name | 2-(1-methylpyrazol-4-yl)-2-(4-thiophen-2-ylbutanoylamino)acetic acid |
|---|---|
| PubChem CID | 115288173 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-2-(4-thiophen-2-ylbutanoylamino)acetic acid |
| SMILES | Cn1cc(C(NC(=O)CCCc2cccs2)C(=O)O)cn1 |
| InChI | InChI=1S/C14H17N3O3S/c1-17-9-10(8-15-17)13(14(19)20)16-12(18)6-2-4-11-5-3-7-21-11/h3,5,7-9,13H,2,4,6H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | SUJPFQBJSDKKNA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |