C17H16ClNO — CID 11529339
3-[1-(4-chlorophenyl)-3-hydroxybutan-2-yl]benzonitrile (PubChem CID 11529339) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-3-hydroxybutan-2-yl]benzonitrile.
| Compound Name | 3-[1-(4-chlorophenyl)-3-hydroxybutan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 11529339 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-3-hydroxybutan-2-yl]benzonitrile |
| SMILES | CC(O)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H16ClNO/c1-12(20)17(10-13-5-7-16(18)8-6-13)15-4-2-3-14(9-15)11-19/h2-9,12,17,20H,10H2,1H3 |
| InChIKey | ZZKVEFYFXLIAQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |