C23H25ClN2O — CID 69205441
N-[(3S)-4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-1-methylcyclobutane-1-carboxamide (PubChem CID 69205441) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is N-[(3S)-4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-1-methylcyclobutane-1-carboxamide.
| Compound Name | N-[(3S)-4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-1-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 69205441 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(3S)-4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-1-methylcyclobutane-1-carboxamide |
| SMILES | CC(NC(=O)C1(C)CCC1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C23H25ClN2O/c1-16(26-22(27)23(2)11-4-12-23)21(14-17-7-9-20(24)10-8-17)19-6-3-5-18(13-19)15-25/h3,5-10,13,16,21H,4,11-12,14H2,1-2H3,(H,26,27)/t16?,21-/m1/s1 |
| InChIKey | QVFAJTAYWLGKRH-CAWMZFRYSA-N |
| XLogP | 5.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |