C14H18N2O4 — CID 115294563
4-amino-N-(1,3-benzodioxol-4-ylmethyl)oxane-4-carboxamide (PubChem CID 115294563) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzodioxol-4-ylmethyl)oxane-4-carboxamide.
| Compound Name | 4-amino-N-(1,3-benzodioxol-4-ylmethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 115294563 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-amino-N-(1,3-benzodioxol-4-ylmethyl)oxane-4-carboxamide |
| SMILES | NC1(C(=O)NCc2cccc3c2OCO3)CCOCC1 |
| InChI | InChI=1S/C14H18N2O4/c15-14(4-6-18-7-5-14)13(17)16-8-10-2-1-3-11-12(10)20-9-19-11/h1-3H,4-9,15H2,(H,16,17) |
| InChIKey | RAVLXGYNVSTHOT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |