C11H13NO5 — CID 79348889
2-hydroxyethyl N-(1,3-benzodioxol-4-ylmethyl)carbamate (PubChem CID 79348889) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-hydroxyethyl N-(1,3-benzodioxol-4-ylmethyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(1,3-benzodioxol-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 79348889 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-hydroxyethyl N-(1,3-benzodioxol-4-ylmethyl)carbamate |
| SMILES | O=C(NCc1cccc2c1OCO2)OCCO |
| InChI | InChI=1S/C11H13NO5/c13-4-5-15-11(14)12-6-8-2-1-3-9-10(8)17-7-16-9/h1-3,13H,4-7H2,(H,12,14) |
| InChIKey | KYXSJODJLVQSHY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |