C12H15NO4 — CID 112738825
propyl N-(1,3-benzodioxol-4-ylmethyl)carbamate (PubChem CID 112738825) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is propyl N-(1,3-benzodioxol-4-ylmethyl)carbamate.
| Compound Name | propyl N-(1,3-benzodioxol-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 112738825 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | propyl N-(1,3-benzodioxol-4-ylmethyl)carbamate |
| SMILES | CCCOC(=O)NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-2-6-15-12(14)13-7-9-4-3-5-10-11(9)17-8-16-10/h3-5H,2,6-8H2,1H3,(H,13,14) |
| InChIKey | ZATGUIPTLMHOMA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |