C12H16N2O2S — CID 75416671
1-(1,3-benzodioxol-4-ylmethyl)-3-propylthiourea (PubChem CID 75416671) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-4-ylmethyl)-3-propylthiourea.
| Compound Name | 1-(1,3-benzodioxol-4-ylmethyl)-3-propylthiourea |
|---|---|
| PubChem CID | 75416671 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-(1,3-benzodioxol-4-ylmethyl)-3-propylthiourea |
| SMILES | CCCNC(=S)NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C12H16N2O2S/c1-2-6-13-12(17)14-7-9-4-3-5-10-11(9)16-8-15-10/h3-5H,2,6-8H2,1H3,(H2,13,14,17) |
| InChIKey | RECKVDCAUMAPEE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|