C12H14FNO2S — CID 115299119
(5-fluoro-2-hydroxyphenyl)-(3-methylthiomorpholin-4-yl)methanone (PubChem CID 115299119) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is (5-fluoro-2-hydroxyphenyl)-(3-methylthiomorpholin-4-yl)methanone.
| Compound Name | (5-fluoro-2-hydroxyphenyl)-(3-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 115299119 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (5-fluoro-2-hydroxyphenyl)-(3-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CSCCN1C(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C12H14FNO2S/c1-8-7-17-5-4-14(8)12(16)10-6-9(13)2-3-11(10)15/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | ATQAGLHMPDXTCG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |