C12H14FNOS2 — CID 107030386
(2-fluoro-5-sulfanylphenyl)-(3-methylthiomorpholin-4-yl)methanone (PubChem CID 107030386) has the molecular formula C12H14FNOS2 and a molecular weight of 271.38 g/mol. Its IUPAC name is (2-fluoro-5-sulfanylphenyl)-(3-methylthiomorpholin-4-yl)methanone.
| Compound Name | (2-fluoro-5-sulfanylphenyl)-(3-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107030386 |
| Molecular Formula | C12H14FNOS2 |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (2-fluoro-5-sulfanylphenyl)-(3-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CSCCN1C(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C12H14FNOS2/c1-8-7-17-5-4-14(8)12(15)10-6-9(16)2-3-11(10)13/h2-3,6,8,16H,4-5,7H2,1H3 |
| InChIKey | GNZCZXSVGWVABS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|