C19H19FN2O2 — CID 11529933
2-[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile (PubChem CID 11529933) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile.
| Compound Name | 2-[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 11529933 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(F)cc1)N(CC#N)CC2 |
| InChI | InChI=1S/C19H19FN2O2/c1-23-17-11-14-7-9-22(10-8-21)19(16(14)12-18(17)24-2)13-3-5-15(20)6-4-13/h3-6,11-12,19H,7,9-10H2,1-2H3 |
| InChIKey | FZBMUYASOVFTKA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|