About N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine
N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine (PubChem CID 115303228) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine |
| PubChem CID | 115303228 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine |
| SMILES | CCC(CC)NCC(C)CNC |
| InChI | InChI=1S/C10H24N2/c1-5-10(6-2)12-8-9(3)7-11-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | FZDOAXMDHYSJFW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine?
The IUPAC name of N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine (CID 115303228) is N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine.
What is the SMILES notation for N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine?
The canonical SMILES for N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine is CCC(CC)NCC(C)CNC.
What is the InChIKey of N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine?
The InChIKey is FZDOAXMDHYSJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-5-10(6-2)12-8-9(3)7-11-4/h9-12H,5-8H2,1-4H3.
What are the key properties of N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine?
N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine has a molecular weight of 172.32 g/mol, XLogP of 1.62, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N'-pentan-3-ylpropane-1,3-diamine is sourced from PubChem (CID 115303228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).