C12H28N2 — CID 79201836
N-heptan-2-yl-N',2-dimethylpropane-1,3-diamine (PubChem CID 79201836) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N-heptan-2-yl-N',2-dimethylpropane-1,3-diamine.
| Compound Name | N-heptan-2-yl-N',2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79201836 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N-heptan-2-yl-N',2-dimethylpropane-1,3-diamine |
| SMILES | CCCCCC(C)NCC(C)CNC |
| InChI | InChI=1S/C12H28N2/c1-5-6-7-8-12(3)14-10-11(2)9-13-4/h11-14H,5-10H2,1-4H3 |
| InChIKey | DKKIACASKXZLFA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|