C14H32N2 — CID 43109334
1-N-heptan-2-yl-2-N,2-N,3-trimethylbutane-1,2-diamine (PubChem CID 43109334) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-N-heptan-2-yl-2-N,2-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 1-N-heptan-2-yl-2-N,2-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 43109334 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 1-N-heptan-2-yl-2-N,2-N,3-trimethylbutane-1,2-diamine |
| SMILES | CCCCCC(C)NCC(C(C)C)N(C)C |
| InChI | InChI=1S/C14H32N2/c1-7-8-9-10-13(4)15-11-14(12(2)3)16(5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | REOJUXLTWSYFQQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|