C14H32N2 — CID 65295730
1-N-hexan-2-yl-2-methylheptane-1,6-diamine (PubChem CID 65295730) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-N-hexan-2-yl-2-methylheptane-1,6-diamine.
| Compound Name | 1-N-hexan-2-yl-2-methylheptane-1,6-diamine |
|---|---|
| PubChem CID | 65295730 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 1-N-hexan-2-yl-2-methylheptane-1,6-diamine |
| SMILES | CCCCC(C)NCC(C)CCCC(C)N |
| InChI | InChI=1S/C14H32N2/c1-5-6-10-14(4)16-11-12(2)8-7-9-13(3)15/h12-14,16H,5-11,15H2,1-4H3 |
| InChIKey | LCWWJVHZVCRFEU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |