C12H28N2 — CID 62200998
1-N-hexan-2-yl-4-methylpentane-1,2-diamine (PubChem CID 62200998) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 1-N-hexan-2-yl-4-methylpentane-1,2-diamine.
| Compound Name | 1-N-hexan-2-yl-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62200998 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 1-N-hexan-2-yl-4-methylpentane-1,2-diamine |
| SMILES | CCCCC(C)NCC(N)CC(C)C |
| InChI | InChI=1S/C12H28N2/c1-5-6-7-11(4)14-9-12(13)8-10(2)3/h10-12,14H,5-9,13H2,1-4H3 |
| InChIKey | XEAGHGZCLXSVFY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |