C16H22BrN3 — CID 115304190
1-[(5-bromo-1H-indol-3-yl)methyl]-N,4-dimethylpiperidin-4-amine (PubChem CID 115304190) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-[(5-bromo-1H-indol-3-yl)methyl]-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-[(5-bromo-1H-indol-3-yl)methyl]-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115304190 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[(5-bromo-1H-indol-3-yl)methyl]-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(Cc2c[nH]c3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C16H22BrN3/c1-16(18-2)5-7-20(8-6-16)11-12-10-19-15-4-3-13(17)9-14(12)15/h3-4,9-10,18-19H,5-8,11H2,1-2H3 |
| InChIKey | AUZMRCNNVWUBHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |