C18H32N2 — CID 115305138
1-(1-adamantylmethyl)-N,4-dimethylpiperidin-4-amine (PubChem CID 115305138) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-(1-adamantylmethyl)-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115305138 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1-(1-adamantylmethyl)-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C18H32N2/c1-17(19-2)3-5-20(6-4-17)13-18-10-14-7-15(11-18)9-16(8-14)12-18/h14-16,19H,3-13H2,1-2H3 |
| InChIKey | YSXJQMFMNKTZLF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |