C11H25N3O — CID 115305870
1-(2-amino-2-ethylbutyl)-3-tert-butylurea (PubChem CID 115305870) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(2-amino-2-ethylbutyl)-3-tert-butylurea.
| Compound Name | 1-(2-amino-2-ethylbutyl)-3-tert-butylurea |
|---|---|
| PubChem CID | 115305870 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 1-(2-amino-2-ethylbutyl)-3-tert-butylurea |
| SMILES | CCC(N)(CC)CNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H25N3O/c1-6-11(12,7-2)8-13-9(15)14-10(3,4)5/h6-8,12H2,1-5H3,(H2,13,14,15) |
| InChIKey | PIGAEUUYDYRTQK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |