C15H22N4O2 — CID 115307635
methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]pyrimidine-2-carboxylate (PubChem CID 115307635) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 115307635 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(N2CCC(NCC3CC3)CC2)n1 |
| InChI | InChI=1S/C15H22N4O2/c1-21-15(20)14-16-7-4-13(18-14)19-8-5-12(6-9-19)17-10-11-2-3-11/h4,7,11-12,17H,2-3,5-6,8-10H2,1H3 |
| InChIKey | ZPVABIHUVKVHGV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |