C15H20Cl2N2O — CID 115308514
N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide (PubChem CID 115308514) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide.
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 115308514 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide |
| SMILES | CC1CCCCC1(CN)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10-4-2-3-7-15(10,9-18)19-14(20)11-5-6-12(16)13(17)8-11/h5-6,8,10H,2-4,7,9,18H2,1H3,(H,19,20) |
| InChIKey | BPKIJMLMULRKBH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |