About N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide
N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide (PubChem CID 115308514) has the molecular formula C15H20Cl2N2O
and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide |
| PubChem CID | 115308514 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide |
| SMILES | CC1CCCCC1(CN)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10-4-2-3-7-15(10,9-18)19-14(20)11-5-6-12(16)13(17)8-11/h5-6,8,10H,2-4,7,9,18H2,1H3,(H,19,20) |
| InChIKey | BPKIJMLMULRKBH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide?
The IUPAC name of N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide (CID 115308514) is N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide.
What is the SMILES notation for N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide?
The canonical SMILES for N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide is CC1CCCCC1(CN)NC(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide?
The InChIKey is BPKIJMLMULRKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O/c1-10-4-2-3-7-15(10,9-18)19-14(20)11-5-6-12(16)13(17)8-11/h5-6,8,10H,2-4,7,9,18H2,1H3,(H,19,20).
What are the key properties of N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide?
N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide has a molecular weight of 315.24 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-2-methylcyclohexyl]-3,4-dichlorobenzamide is sourced from PubChem (CID 115308514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).